About N-cyclopentyl-4-oxo-2,3-dihydroquinoline-1-sulfonamide
N-cyclopentyl-4-oxo-2,3-dihydroquinoline-1-sulfonamide (PubChem CID 110612616) has the molecular formula C14H18N2O3S
and a molecular weight of 294.38 g/mol. Its IUPAC name is N-cyclopentyl-4-oxo-2,3-dihydroquinoline-1-sulfonamide.
Molecular Properties
| Compound Name | N-cyclopentyl-4-oxo-2,3-dihydroquinoline-1-sulfonamide |
| PubChem CID | 110612616 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-cyclopentyl-4-oxo-2,3-dihydroquinoline-1-sulfonamide |
| SMILES | O=C1CCN(S(=O)(=O)NC2CCCC2)c2ccccc21 |
| InChI | InChI=1S/C14H18N2O3S/c17-14-9-10-16(13-8-4-3-7-12(13)14)20(18,19)15-11-5-1-2-6-11/h3-4,7-8,11,15H,1-2,5-6,9-10H2 |
| InChIKey | FYZMZBRLNUBETQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopentyl-4-oxo-2,3-dihydroquinoline-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-4-oxo-2,3-dihydroquinoline-1-sulfonamide?
The IUPAC name of N-cyclopentyl-4-oxo-2,3-dihydroquinoline-1-sulfonamide (CID 110612616) is N-cyclopentyl-4-oxo-2,3-dihydroquinoline-1-sulfonamide.
What is the SMILES notation for N-cyclopentyl-4-oxo-2,3-dihydroquinoline-1-sulfonamide?
The canonical SMILES for N-cyclopentyl-4-oxo-2,3-dihydroquinoline-1-sulfonamide is O=C1CCN(S(=O)(=O)NC2CCCC2)c2ccccc21.
What is the InChIKey of N-cyclopentyl-4-oxo-2,3-dihydroquinoline-1-sulfonamide?
The InChIKey is FYZMZBRLNUBETQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3S/c17-14-9-10-16(13-8-4-3-7-12(13)14)20(18,19)15-11-5-1-2-6-11/h3-4,7-8,11,15H,1-2,5-6,9-10H2.
What are the key properties of N-cyclopentyl-4-oxo-2,3-dihydroquinoline-1-sulfonamide?
N-cyclopentyl-4-oxo-2,3-dihydroquinoline-1-sulfonamide has a molecular weight of 294.38 g/mol, XLogP of 1.86, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-4-oxo-2,3-dihydroquinoline-1-sulfonamide is sourced from PubChem (CID 110612616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).