C22H26N2O4 — CID 110613161
2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(2-methoxy-5-piperidin-1-ylphenyl)acetamide (PubChem CID 110613161) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(2-methoxy-5-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(2-methoxy-5-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 110613161 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(2-methoxy-5-piperidin-1-ylphenyl)acetamide |
| SMILES | COc1ccc(N2CCCCC2)cc1NC(=O)Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H26N2O4/c1-26-19-8-6-17(24-9-3-2-4-10-24)15-18(19)23-22(25)14-16-5-7-20-21(13-16)28-12-11-27-20/h5-8,13,15H,2-4,9-12,14H2,1H3,(H,23,25) |
| InChIKey | KNYAVLOAZAHWCC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|