C35H48FNO10 — CID 11061338
[(2S,3S,4R,5R)-5-[[(2R,3R,4R)-2-[(1R)-1,2-dihydroxyethyl]-4-fluoro-3-hydroxypyrrolidin-1-yl]methyl]-2-(9-methoxy-9-oxononoxy)-4-phenylmethoxyoxolan-3-yl] benzoate (PubChem CID 11061338) has the molecular formula C35H48FNO10 and a molecular weight of 661.76 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[[(2R,3R,4R)-2-[(1R)-1,2-dihydroxyethyl]-4-fluoro-3-hydroxypyrrolidin-1-yl]methyl]-2-(9-methoxy-9-oxononoxy)-4-phenylmethoxyoxolan-3-yl] benzoate.
| Compound Name | [(2S,3S,4R,5R)-5-[[(2R,3R,4R)-2-[(1R)-1,2-dihydroxyethyl]-4-fluoro-3-hydroxypyrrolidin-1-yl]methyl]-2-(9-methoxy-9-oxononoxy)-4-phenylmethoxyoxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 11061338 |
| Molecular Formula | C35H48FNO10 |
| Molecular Weight | 661.76 g/mol |
| Exact Mass | 661.33 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[[(2R,3R,4R)-2-[(1R)-1,2-dihydroxyethyl]-4-fluoro-3-hydroxypyrrolidin-1-yl]methyl]-2-(9-methoxy-9-oxononoxy)-4-phenylmethoxyoxolan-3-yl] benzoate |
| SMILES | COC(=O)CCCCCCCCO[C@H]1O[C@H](CN2C[C@@H](F)[C@H](O)[C@H]2[C@@H](O)CO)[C@@H](OCc2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H48FNO10/c1-43-29(40)18-12-4-2-3-5-13-19-44-35-33(47-34(42)25-16-10-7-11-17-25)32(45-23-24-14-8-6-9-15-24)28(46-35)21-37-20-26(36)31(41)30(37)27(39)22-38/h6-11,14-17,26-28,30-33,35,38-39,41H,2-5,12-13,18-23H2,1H3/t26-,27+,28-,30-,31+,32-,33+,35+/m1/s1 |
| InChIKey | RDAWMMPIJFAQCI-AWVMCLLQSA-N |
| XLogP | 3.18 |
| TPSA | 144.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.76 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|