About bis(4-di(propan-2-yl)phosphanylbutyl-di(propan-2-yl)phosphane);palladium
bis(4-di(propan-2-yl)phosphanylbutyl-di(propan-2-yl)phosphane);palladium (PubChem CID 11061444) has the molecular formula C32H72P4Pd
and a molecular weight of 687.24 g/mol. Its IUPAC name is bis(4-di(propan-2-yl)phosphanylbutyl-di(propan-2-yl)phosphane);palladium.
Molecular Properties
| Compound Name | bis(4-di(propan-2-yl)phosphanylbutyl-di(propan-2-yl)phosphane);palladium |
| PubChem CID | 11061444 |
| Molecular Formula | C32H72P4Pd |
| Molecular Weight | 687.24 g/mol |
| Exact Mass | 686.36 |
| IUPAC Name | bis(4-di(propan-2-yl)phosphanylbutyl-di(propan-2-yl)phosphane);palladium |
| SMILES | CC(C)P(CCCCP(C(C)C)C(C)C)C(C)C.CC(C)P(CCCCP(C(C)C)C(C)C)C(C)C.[Pd] |
| InChI | InChI=1S/2C16H36P2.Pd/c2*1-13(2)17(14(3)4)11-9-10-12-18(15(5)6)16(7)8;/h2*13-16H,9-12H2,1-8H3; |
| InChIKey | CCPBZIMRPLFTAC-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 687.24 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(4-di(propan-2-yl)phosphanylbutyl-di(propan-2-yl)phosphane);palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-di(propan-2-yl)phosphanylbutyl-di(propan-2-yl)phosphane);palladium?
The IUPAC name of bis(4-di(propan-2-yl)phosphanylbutyl-di(propan-2-yl)phosphane);palladium (CID 11061444) is bis(4-di(propan-2-yl)phosphanylbutyl-di(propan-2-yl)phosphane);palladium.
What is the SMILES notation for bis(4-di(propan-2-yl)phosphanylbutyl-di(propan-2-yl)phosphane);palladium?
The canonical SMILES for bis(4-di(propan-2-yl)phosphanylbutyl-di(propan-2-yl)phosphane);palladium is CC(C)P(CCCCP(C(C)C)C(C)C)C(C)C.CC(C)P(CCCCP(C(C)C)C(C)C)C(C)C.[Pd].
What is the InChIKey of bis(4-di(propan-2-yl)phosphanylbutyl-di(propan-2-yl)phosphane);palladium?
The InChIKey is CCPBZIMRPLFTAC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H36P2.Pd/c2*1-13(2)17(14(3)4)11-9-10-12-18(15(5)6)16(7)8;/h2*13-16H,9-12H2,1-8H3;.
What are the key properties of bis(4-di(propan-2-yl)phosphanylbutyl-di(propan-2-yl)phosphane);palladium?
bis(4-di(propan-2-yl)phosphanylbutyl-di(propan-2-yl)phosphane);palladium has a molecular weight of 687.24 g/mol, XLogP of 12.73, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-di(propan-2-yl)phosphanylbutyl-di(propan-2-yl)phosphane);palladium is sourced from PubChem (CID 11061444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).