C17H13BrFN3O2 — CID 110614696
N-(6-bromo-3-pyridinyl)-2-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]acetamide (PubChem CID 110614696) has the molecular formula C17H13BrFN3O2 and a molecular weight of 390.21 g/mol. Its IUPAC name is N-(6-bromo-3-pyridinyl)-2-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]acetamide.
| Compound Name | N-(6-bromo-3-pyridinyl)-2-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]acetamide |
|---|---|
| PubChem CID | 110614696 |
| Molecular Formula | C17H13BrFN3O2 |
| Molecular Weight | 390.21 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | N-(6-bromo-3-pyridinyl)-2-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]acetamide |
| SMILES | Cc1oc(-c2ccc(F)cc2)nc1CC(=O)Nc1ccc(Br)nc1 |
| InChI | InChI=1S/C17H13BrFN3O2/c1-10-14(8-16(23)21-13-6-7-15(18)20-9-13)22-17(24-10)11-2-4-12(19)5-3-11/h2-7,9H,8H2,1H3,(H,21,23) |
| InChIKey | MLZNLWGWTKVNQU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.21 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|