C34H74O7Si4 — CID 11061521
2-[[(2R,3R,5Z,8S,9S)-2,9-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-8-(2-trimethylsilylethoxymethoxy)-2,3,4,7,8,9-hexahydrooxonin-3-yl]oxymethoxy]ethyl-trimethylsilane (PubChem CID 11061521) has the molecular formula C34H74O7Si4 and a molecular weight of 707.30 g/mol. Its IUPAC name is 2-[[(2R,3R,5Z,8S,9S)-2,9-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-8-(2-trimethylsilylethoxymethoxy)-2,3,4,7,8,9-hexahydrooxonin-3-yl]oxymethoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(2R,3R,5Z,8S,9S)-2,9-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-8-(2-trimethylsilylethoxymethoxy)-2,3,4,7,8,9-hexahydrooxonin-3-yl]oxymethoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 11061521 |
| Molecular Formula | C34H74O7Si4 |
| Molecular Weight | 707.30 g/mol |
| Exact Mass | 706.45 |
| IUPAC Name | 2-[[(2R,3R,5Z,8S,9S)-2,9-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-8-(2-trimethylsilylethoxymethoxy)-2,3,4,7,8,9-hexahydrooxonin-3-yl]oxymethoxy]ethyl-trimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](OCOCC[Si](C)(C)C)C/C=C\C[C@@H]1OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C34H74O7Si4/c1-33(2,3)44(13,14)39-25-31-29(37-27-35-21-23-42(7,8)9)19-17-18-20-30(38-28-36-22-24-43(10,11)12)32(41-31)26-40-45(15,16)34(4,5)6/h17-18,29-32H,19-28H2,1-16H3/b18-17-/t29-,30+,31-,32+ |
| InChIKey | XFMPCCCSCSHPAU-FFQHVZPXSA-N |
| XLogP | 9.53 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.30 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|