C23H24N2O3 — CID 110616654
3-cyclopropyl-3-(4-methoxyphenyl)-N-[(2-oxo-1H-quinolin-3-yl)methyl]propanamide (PubChem CID 110616654) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-cyclopropyl-3-(4-methoxyphenyl)-N-[(2-oxo-1H-quinolin-3-yl)methyl]propanamide.
| Compound Name | 3-cyclopropyl-3-(4-methoxyphenyl)-N-[(2-oxo-1H-quinolin-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 110616654 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-cyclopropyl-3-(4-methoxyphenyl)-N-[(2-oxo-1H-quinolin-3-yl)methyl]propanamide |
| SMILES | COc1ccc(C(CC(=O)NCc2cc3ccccc3[nH]c2=O)C2CC2)cc1 |
| InChI | InChI=1S/C23H24N2O3/c1-28-19-10-8-16(9-11-19)20(15-6-7-15)13-22(26)24-14-18-12-17-4-2-3-5-21(17)25-23(18)27/h2-5,8-12,15,20H,6-7,13-14H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | UYHCYONKWPJRBI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |