About 2-chloro-6,8-dimethyl-N-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]quinoline-3-carboxamide
2-chloro-6,8-dimethyl-N-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]quinoline-3-carboxamide (PubChem CID 110617579) has the molecular formula C21H19ClN4O2
and a molecular weight of 394.86 g/mol. Its IUPAC name is 2-chloro-6,8-dimethyl-N-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]quinoline-3-carboxamide.
Molecular Properties
| Compound Name | 2-chloro-6,8-dimethyl-N-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]quinoline-3-carboxamide |
| PubChem CID | 110617579 |
| Molecular Formula | C21H19ClN4O2 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 2-chloro-6,8-dimethyl-N-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]quinoline-3-carboxamide |
| SMILES | Cc1cc(C)c2nc(Cl)c(C(=O)NCCn3c(=O)[nH]c4ccccc43)cc2c1 |
| InChI | InChI=1S/C21H19ClN4O2/c1-12-9-13(2)18-14(10-12)11-15(19(22)25-18)20(27)23-7-8-26-17-6-4-3-5-16(17)24-21(26)28/h3-6,9-11H,7-8H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | MGOMTICOTGHBNN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6,8-dimethyl-N-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]quinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6,8-dimethyl-N-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]quinoline-3-carboxamide?
The IUPAC name of 2-chloro-6,8-dimethyl-N-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]quinoline-3-carboxamide (CID 110617579) is 2-chloro-6,8-dimethyl-N-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]quinoline-3-carboxamide.
What is the SMILES notation for 2-chloro-6,8-dimethyl-N-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]quinoline-3-carboxamide?
The canonical SMILES for 2-chloro-6,8-dimethyl-N-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]quinoline-3-carboxamide is Cc1cc(C)c2nc(Cl)c(C(=O)NCCn3c(=O)[nH]c4ccccc43)cc2c1.
What is the InChIKey of 2-chloro-6,8-dimethyl-N-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]quinoline-3-carboxamide?
The InChIKey is MGOMTICOTGHBNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19ClN4O2/c1-12-9-13(2)18-14(10-12)11-15(19(22)25-18)20(27)23-7-8-26-17-6-4-3-5-16(17)24-21(26)28/h3-6,9-11H,7-8H2,1-2H3,(H,23,27)(H,24,28).
What are the key properties of 2-chloro-6,8-dimethyl-N-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]quinoline-3-carboxamide?
2-chloro-6,8-dimethyl-N-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]quinoline-3-carboxamide has a molecular weight of 394.86 g/mol, XLogP of 3.58, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6,8-dimethyl-N-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]quinoline-3-carboxamide is sourced from PubChem (CID 110617579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).