C18H18ClN3O3 — CID 110617707
1-[(3-chlorophenyl)methyl]-3-[4-(3-oxomorpholin-4-yl)phenyl]urea (PubChem CID 110617707) has the molecular formula C18H18ClN3O3 and a molecular weight of 359.81 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-[4-(3-oxomorpholin-4-yl)phenyl]urea.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-[4-(3-oxomorpholin-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 110617707 |
| Molecular Formula | C18H18ClN3O3 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-[4-(3-oxomorpholin-4-yl)phenyl]urea |
| SMILES | O=C(NCc1cccc(Cl)c1)Nc1ccc(N2CCOCC2=O)cc1 |
| InChI | InChI=1S/C18H18ClN3O3/c19-14-3-1-2-13(10-14)11-20-18(24)21-15-4-6-16(7-5-15)22-8-9-25-12-17(22)23/h1-7,10H,8-9,11-12H2,(H2,20,21,24) |
| InChIKey | SMRYHWNCLGSYEV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |