C22H30N4O — CID 110617732
2-(dimethylamino)-N-(3-phenyl-2-piperidin-1-ylpropyl)pyridine-3-carboxamide (PubChem CID 110617732) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is 2-(dimethylamino)-N-(3-phenyl-2-piperidin-1-ylpropyl)pyridine-3-carboxamide.
| Compound Name | 2-(dimethylamino)-N-(3-phenyl-2-piperidin-1-ylpropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110617732 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 2-(dimethylamino)-N-(3-phenyl-2-piperidin-1-ylpropyl)pyridine-3-carboxamide |
| SMILES | CN(C)c1ncccc1C(=O)NCC(Cc1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C22H30N4O/c1-25(2)21-20(12-9-13-23-21)22(27)24-17-19(26-14-7-4-8-15-26)16-18-10-5-3-6-11-18/h3,5-6,9-13,19H,4,7-8,14-17H2,1-2H3,(H,24,27) |
| InChIKey | KTEMDJZNHBTKIW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |