C19H29NO3 — CID 110617824
N-(4,4-dimethylpentyl)-5-(4-methoxyphenyl)-5-oxopentanamide (PubChem CID 110617824) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is N-(4,4-dimethylpentyl)-5-(4-methoxyphenyl)-5-oxopentanamide.
| Compound Name | N-(4,4-dimethylpentyl)-5-(4-methoxyphenyl)-5-oxopentanamide |
|---|---|
| PubChem CID | 110617824 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | N-(4,4-dimethylpentyl)-5-(4-methoxyphenyl)-5-oxopentanamide |
| SMILES | COc1ccc(C(=O)CCCC(=O)NCCCC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H29NO3/c1-19(2,3)13-6-14-20-18(22)8-5-7-17(21)15-9-11-16(23-4)12-10-15/h9-12H,5-8,13-14H2,1-4H3,(H,20,22) |
| InChIKey | MGGKHWRSTNPKFU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|