C21H32ClN3O2 — CID 110617917
3-(4-chlorophenyl)-1-[4-[3-(dimethylamino)propanoyl]piperazin-1-yl]-4-methylpentan-1-one (PubChem CID 110617917) has the molecular formula C21H32ClN3O2 and a molecular weight of 393.96 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[4-[3-(dimethylamino)propanoyl]piperazin-1-yl]-4-methylpentan-1-one.
| Compound Name | 3-(4-chlorophenyl)-1-[4-[3-(dimethylamino)propanoyl]piperazin-1-yl]-4-methylpentan-1-one |
|---|---|
| PubChem CID | 110617917 |
| Molecular Formula | C21H32ClN3O2 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[4-[3-(dimethylamino)propanoyl]piperazin-1-yl]-4-methylpentan-1-one |
| SMILES | CC(C)C(CC(=O)N1CCN(C(=O)CCN(C)C)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H32ClN3O2/c1-16(2)19(17-5-7-18(22)8-6-17)15-21(27)25-13-11-24(12-14-25)20(26)9-10-23(3)4/h5-8,16,19H,9-15H2,1-4H3 |
| InChIKey | OWMLXTOTSDCYJN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |