About (2E)-2-benzylidene-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)butanamide
(2E)-2-benzylidene-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)butanamide (PubChem CID 110618679) has the molecular formula C21H22N2O2
and a molecular weight of 334.42 g/mol. Its IUPAC name is (2E)-2-benzylidene-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)butanamide.
Molecular Properties
| Compound Name | (2E)-2-benzylidene-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)butanamide |
| PubChem CID | 110618679 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (2E)-2-benzylidene-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)butanamide |
| SMILES | CC/C(=C\c1ccccc1)C(=O)Nc1ccc2c(c1)C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C21H22N2O2/c1-4-15(12-14-8-6-5-7-9-14)19(24)22-16-10-11-18-17(13-16)21(2,3)20(25)23-18/h5-13H,4H2,1-3H3,(H,22,24)(H,23,25)/b15-12+ |
| InChIKey | USQSDZSKTONEAH-NTCAYCPXSA-N |
| XLogP | 4.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-benzylidene-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-benzylidene-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)butanamide?
The IUPAC name of (2E)-2-benzylidene-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)butanamide (CID 110618679) is (2E)-2-benzylidene-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)butanamide.
What is the SMILES notation for (2E)-2-benzylidene-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)butanamide?
The canonical SMILES for (2E)-2-benzylidene-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)butanamide is CC/C(=C\c1ccccc1)C(=O)Nc1ccc2c(c1)C(C)(C)C(=O)N2.
What is the InChIKey of (2E)-2-benzylidene-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)butanamide?
The InChIKey is USQSDZSKTONEAH-NTCAYCPXSA-N. The full InChI is InChI=1S/C21H22N2O2/c1-4-15(12-14-8-6-5-7-9-14)19(24)22-16-10-11-18-17(13-16)21(2,3)20(25)23-18/h5-13H,4H2,1-3H3,(H,22,24)(H,23,25)/b15-12+.
What are the key properties of (2E)-2-benzylidene-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)butanamide?
(2E)-2-benzylidene-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)butanamide has a molecular weight of 334.42 g/mol, XLogP of 4.35, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-benzylidene-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)butanamide is sourced from PubChem (CID 110618679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).