C18H19FN2O2S — CID 110618898
2-(2-fluorophenyl)-N-[(2-methyl-1H-indol-5-yl)methyl]ethanesulfonamide (PubChem CID 110618898) has the molecular formula C18H19FN2O2S and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-[(2-methyl-1H-indol-5-yl)methyl]ethanesulfonamide.
| Compound Name | 2-(2-fluorophenyl)-N-[(2-methyl-1H-indol-5-yl)methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 110618898 |
| Molecular Formula | C18H19FN2O2S |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 2-(2-fluorophenyl)-N-[(2-methyl-1H-indol-5-yl)methyl]ethanesulfonamide |
| SMILES | Cc1cc2cc(CNS(=O)(=O)CCc3ccccc3F)ccc2[nH]1 |
| InChI | InChI=1S/C18H19FN2O2S/c1-13-10-16-11-14(6-7-18(16)21-13)12-20-24(22,23)9-8-15-4-2-3-5-17(15)19/h2-7,10-11,20-21H,8-9,12H2,1H3 |
| InChIKey | SNWLZRBSEJBLRR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |