C21H28N2O3 — CID 110619017
(E)-1-[4-(morpholine-4-carbonyl)piperidin-1-yl]-3-phenylpent-2-en-1-one (PubChem CID 110619017) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is (E)-1-[4-(morpholine-4-carbonyl)piperidin-1-yl]-3-phenylpent-2-en-1-one.
| Compound Name | (E)-1-[4-(morpholine-4-carbonyl)piperidin-1-yl]-3-phenylpent-2-en-1-one |
|---|---|
| PubChem CID | 110619017 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (E)-1-[4-(morpholine-4-carbonyl)piperidin-1-yl]-3-phenylpent-2-en-1-one |
| SMILES | CC/C(=C\C(=O)N1CCC(C(=O)N2CCOCC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H28N2O3/c1-2-17(18-6-4-3-5-7-18)16-20(24)22-10-8-19(9-11-22)21(25)23-12-14-26-15-13-23/h3-7,16,19H,2,8-15H2,1H3/b17-16+ |
| InChIKey | SNVGIJIZHOSJRK-WUKNDPDISA-N |
| XLogP | 2.58 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|