C20H21FN2O2 — CID 110619443
N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-(4-fluorophenyl)butanamide (PubChem CID 110619443) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-(4-fluorophenyl)butanamide.
| Compound Name | N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-(4-fluorophenyl)butanamide |
|---|---|
| PubChem CID | 110619443 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-(4-fluorophenyl)butanamide |
| SMILES | CC(CC(=O)NCC(=O)N1CCc2ccccc21)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H21FN2O2/c1-14(15-6-8-17(21)9-7-15)12-19(24)22-13-20(25)23-11-10-16-4-2-3-5-18(16)23/h2-9,14H,10-13H2,1H3,(H,22,24) |
| InChIKey | NLDDIWRVQZOYQZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |