C19H19FN2O4 — CID 110619456
N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-3-(4-fluorophenyl)butanamide (PubChem CID 110619456) has the molecular formula C19H19FN2O4 and a molecular weight of 358.37 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-3-(4-fluorophenyl)butanamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-3-(4-fluorophenyl)butanamide |
|---|---|
| PubChem CID | 110619456 |
| Molecular Formula | C19H19FN2O4 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-3-(4-fluorophenyl)butanamide |
| SMILES | CC(CC(=O)NCC(=O)Nc1ccc2c(c1)OCO2)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19FN2O4/c1-12(13-2-4-14(20)5-3-13)8-18(23)21-10-19(24)22-15-6-7-16-17(9-15)26-11-25-16/h2-7,9,12H,8,10-11H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | CODPSQPRRADKFR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |