C20H30FN3O — CID 110620590
1-[(2-fluorophenyl)methyl]-N-(2-piperidin-1-ylpropyl)pyrrolidine-2-carboxamide (PubChem CID 110620590) has the molecular formula C20H30FN3O and a molecular weight of 347.48 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-N-(2-piperidin-1-ylpropyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[(2-fluorophenyl)methyl]-N-(2-piperidin-1-ylpropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110620590 |
| Molecular Formula | C20H30FN3O |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-N-(2-piperidin-1-ylpropyl)pyrrolidine-2-carboxamide |
| SMILES | CC(CNC(=O)C1CCCN1Cc1ccccc1F)N1CCCCC1 |
| InChI | InChI=1S/C20H30FN3O/c1-16(23-11-5-2-6-12-23)14-22-20(25)19-10-7-13-24(19)15-17-8-3-4-9-18(17)21/h3-4,8-9,16,19H,2,5-7,10-15H2,1H3,(H,22,25) |
| InChIKey | QGBRILPYVIQJDH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |