C18H25N5O2 — CID 110620977
2-(5-methyl-1,2,4-oxadiazol-3-yl)-N-[4-(4-propylpiperazin-1-yl)phenyl]acetamide (PubChem CID 110620977) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-(5-methyl-1,2,4-oxadiazol-3-yl)-N-[4-(4-propylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-(5-methyl-1,2,4-oxadiazol-3-yl)-N-[4-(4-propylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 110620977 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 2-(5-methyl-1,2,4-oxadiazol-3-yl)-N-[4-(4-propylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CCCN1CCN(c2ccc(NC(=O)Cc3noc(C)n3)cc2)CC1 |
| InChI | InChI=1S/C18H25N5O2/c1-3-8-22-9-11-23(12-10-22)16-6-4-15(5-7-16)20-18(24)13-17-19-14(2)25-21-17/h4-7H,3,8-13H2,1-2H3,(H,20,24) |
| InChIKey | PCRFITQJAYUUAA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|