C19H26N4O2 — CID 110621001
2-(5-methyl-1,2-oxazol-3-yl)-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]acetamide (PubChem CID 110621001) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-(5-methyl-1,2-oxazol-3-yl)-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-(5-methyl-1,2-oxazol-3-yl)-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 110621001 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 2-(5-methyl-1,2-oxazol-3-yl)-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]acetamide |
| SMILES | Cc1cc(CC(=O)Nc2ccc(N3CCN(C(C)C)CC3)cc2)no1 |
| InChI | InChI=1S/C19H26N4O2/c1-14(2)22-8-10-23(11-9-22)18-6-4-16(5-7-18)20-19(24)13-17-12-15(3)25-21-17/h4-7,12,14H,8-11,13H2,1-3H3,(H,20,24) |
| InChIKey | OQXKAGPZNBUUEV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|