C21H32N4O2 — CID 110622654
N-[2-(4-ethylpiperazin-1-yl)-2-methylpropyl]-5-oxo-1-phenylpyrrolidine-2-carboxamide (PubChem CID 110622654) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)-2-methylpropyl]-5-oxo-1-phenylpyrrolidine-2-carboxamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)-2-methylpropyl]-5-oxo-1-phenylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110622654 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)-2-methylpropyl]-5-oxo-1-phenylpyrrolidine-2-carboxamide |
| SMILES | CCN1CCN(C(C)(C)CNC(=O)C2CCC(=O)N2c2ccccc2)CC1 |
| InChI | InChI=1S/C21H32N4O2/c1-4-23-12-14-24(15-13-23)21(2,3)16-22-20(27)18-10-11-19(26)25(18)17-8-6-5-7-9-17/h5-9,18H,4,10-16H2,1-3H3,(H,22,27) |
| InChIKey | QVITWCWTAPYFSQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |