C20H25N3O3S — CID 110622860
2-(dimethylamino)-N-[4-(1,1-dioxothiazinan-2-yl)phenyl]-2-phenylacetamide (PubChem CID 110622860) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[4-(1,1-dioxothiazinan-2-yl)phenyl]-2-phenylacetamide.
| Compound Name | 2-(dimethylamino)-N-[4-(1,1-dioxothiazinan-2-yl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 110622860 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-(dimethylamino)-N-[4-(1,1-dioxothiazinan-2-yl)phenyl]-2-phenylacetamide |
| SMILES | CN(C)C(C(=O)Nc1ccc(N2CCCCS2(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H25N3O3S/c1-22(2)19(16-8-4-3-5-9-16)20(24)21-17-10-12-18(13-11-17)23-14-6-7-15-27(23,25)26/h3-5,8-13,19H,6-7,14-15H2,1-2H3,(H,21,24) |
| InChIKey | NGEXXLIYBPPCNY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |