About (2S)-pent-4-ene-1,2-diol
(2S)-pent-4-ene-1,2-diol (PubChem CID 11062320) has the molecular formula C5H10O2
and a molecular weight of 102.13 g/mol. Its IUPAC name is (2S)-pent-4-ene-1,2-diol.
Molecular Properties
| Compound Name | (2S)-pent-4-ene-1,2-diol |
| PubChem CID | 11062320 |
| Molecular Formula | C5H10O2 |
| Molecular Weight | 102.13 g/mol |
| Exact Mass | 102.07 |
| IUPAC Name | (2S)-pent-4-ene-1,2-diol |
| SMILES | C=CC[C@H](O)CO |
| InChI | InChI=1S/C5H10O2/c1-2-3-5(7)4-6/h2,5-7H,1,3-4H2/t5-/m0/s1 |
| InChIKey | KCPNPXFJBCFNRU-YFKPBYRVSA-N |
| XLogP | -0.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.13 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-pent-4-ene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-pent-4-ene-1,2-diol?
The IUPAC name of (2S)-pent-4-ene-1,2-diol (CID 11062320) is (2S)-pent-4-ene-1,2-diol.
What is the SMILES notation for (2S)-pent-4-ene-1,2-diol?
The canonical SMILES for (2S)-pent-4-ene-1,2-diol is C=CC[C@H](O)CO.
What is the InChIKey of (2S)-pent-4-ene-1,2-diol?
The InChIKey is KCPNPXFJBCFNRU-YFKPBYRVSA-N. The full InChI is InChI=1S/C5H10O2/c1-2-3-5(7)4-6/h2,5-7H,1,3-4H2/t5-/m0/s1.
What are the key properties of (2S)-pent-4-ene-1,2-diol?
(2S)-pent-4-ene-1,2-diol has a molecular weight of 102.13 g/mol, XLogP of -0.08, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-pent-4-ene-1,2-diol is sourced from PubChem (CID 11062320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).