About 3,4,4a,5-tetrahydropyrrolo[1,2-c][1,3]oxazin-1-one
3,4,4a,5-tetrahydropyrrolo[1,2-c][1,3]oxazin-1-one (PubChem CID 11062461) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 3,4,4a,5-tetrahydropyrrolo[1,2-c][1,3]oxazin-1-one.
Analyze 3,4,4a,5-tetrahydropyrrolo[1,2-c][1,3]oxazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,4a,5-tetrahydropyrrolo[1,2-c][1,3]oxazin-1-one?
The IUPAC name of 3,4,4a,5-tetrahydropyrrolo[1,2-c][1,3]oxazin-1-one (CID 11062461) is 3,4,4a,5-tetrahydropyrrolo[1,2-c][1,3]oxazin-1-one.
What is the SMILES notation for 3,4,4a,5-tetrahydropyrrolo[1,2-c][1,3]oxazin-1-one?
The canonical SMILES for 3,4,4a,5-tetrahydropyrrolo[1,2-c][1,3]oxazin-1-one is O=C1OCCC2CC=CN12.
What is the InChIKey of 3,4,4a,5-tetrahydropyrrolo[1,2-c][1,3]oxazin-1-one?
The InChIKey is KBPCUTOPBROCKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c9-7-8-4-1-2-6(8)3-5-10-7/h1,4,6H,2-3,5H2.
What are the key properties of 3,4,4a,5-tetrahydropyrrolo[1,2-c][1,3]oxazin-1-one?
3,4,4a,5-tetrahydropyrrolo[1,2-c][1,3]oxazin-1-one has a molecular weight of 139.15 g/mol, XLogP of 1.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,4a,5-tetrahydropyrrolo[1,2-c][1,3]oxazin-1-one is sourced from PubChem (CID 11062461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).