C9H12O2 — CID 11062563
(1R,5R)-1,5-dimethyl-8-oxabicyclo[3.2.1]oct-2-en-6-one (PubChem CID 11062563) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is (1R,5R)-1,5-dimethyl-8-oxabicyclo[3.2.1]oct-2-en-6-one.
| Compound Name | (1R,5R)-1,5-dimethyl-8-oxabicyclo[3.2.1]oct-2-en-6-one |
|---|---|
| PubChem CID | 11062563 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (1R,5R)-1,5-dimethyl-8-oxabicyclo[3.2.1]oct-2-en-6-one |
| SMILES | C[C@@]12C=CC[C@@](C)(O1)C(=O)C2 |
| InChI | InChI=1S/C9H12O2/c1-8-4-3-5-9(2,11-8)7(10)6-8/h3-4H,5-6H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | ABOZUBZHMKZPTF-DTWKUNHWSA-N |
| XLogP | 1.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|