C24H28N2O3 — CID 110625844
N-benzyl-1-[4-(3,4-dimethylphenyl)-4-oxobutanoyl]pyrrolidine-2-carboxamide (PubChem CID 110625844) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-benzyl-1-[4-(3,4-dimethylphenyl)-4-oxobutanoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-benzyl-1-[4-(3,4-dimethylphenyl)-4-oxobutanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110625844 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N-benzyl-1-[4-(3,4-dimethylphenyl)-4-oxobutanoyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)N2CCCC2C(=O)NCc2ccccc2)cc1C |
| InChI | InChI=1S/C24H28N2O3/c1-17-10-11-20(15-18(17)2)22(27)12-13-23(28)26-14-6-9-21(26)24(29)25-16-19-7-4-3-5-8-19/h3-5,7-8,10-11,15,21H,6,9,12-14,16H2,1-2H3,(H,25,29) |
| InChIKey | TVEDAFAWVKUXRM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |