About (2E)-2-(2,3-dihydroinden-1-ylidene)acetonitrile
(2E)-2-(2,3-dihydroinden-1-ylidene)acetonitrile (PubChem CID 11062613) has the molecular formula C11H9N
and a molecular weight of 155.20 g/mol. Its IUPAC name is (2E)-2-(2,3-dihydroinden-1-ylidene)acetonitrile.
Molecular Properties
| Compound Name | (2E)-2-(2,3-dihydroinden-1-ylidene)acetonitrile |
| PubChem CID | 11062613 |
| Molecular Formula | C11H9N |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | (2E)-2-(2,3-dihydroinden-1-ylidene)acetonitrile |
| SMILES | N#C/C=C1\CCc2ccccc21 |
| InChI | InChI=1S/C11H9N/c12-8-7-10-6-5-9-3-1-2-4-11(9)10/h1-4,7H,5-6H2/b10-7+ |
| InChIKey | YPIUDDKTEDBMEC-JXMROGBWSA-N |
| XLogP | 2.54 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(2,3-dihydroinden-1-ylidene)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(2,3-dihydroinden-1-ylidene)acetonitrile?
The IUPAC name of (2E)-2-(2,3-dihydroinden-1-ylidene)acetonitrile (CID 11062613) is (2E)-2-(2,3-dihydroinden-1-ylidene)acetonitrile.
What is the SMILES notation for (2E)-2-(2,3-dihydroinden-1-ylidene)acetonitrile?
The canonical SMILES for (2E)-2-(2,3-dihydroinden-1-ylidene)acetonitrile is N#C/C=C1\CCc2ccccc21.
What is the InChIKey of (2E)-2-(2,3-dihydroinden-1-ylidene)acetonitrile?
The InChIKey is YPIUDDKTEDBMEC-JXMROGBWSA-N. The full InChI is InChI=1S/C11H9N/c12-8-7-10-6-5-9-3-1-2-4-11(9)10/h1-4,7H,5-6H2/b10-7+.
What are the key properties of (2E)-2-(2,3-dihydroinden-1-ylidene)acetonitrile?
(2E)-2-(2,3-dihydroinden-1-ylidene)acetonitrile has a molecular weight of 155.20 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(2,3-dihydroinden-1-ylidene)acetonitrile is sourced from PubChem (CID 11062613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).