C23H24N2O3 — CID 110627981
(E)-N-[4-(4-methoxyphenyl)butyl]-3-(2-oxo-1H-quinolin-3-yl)prop-2-enamide (PubChem CID 110627981) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is (E)-N-[4-(4-methoxyphenyl)butyl]-3-(2-oxo-1H-quinolin-3-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-(4-methoxyphenyl)butyl]-3-(2-oxo-1H-quinolin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 110627981 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (E)-N-[4-(4-methoxyphenyl)butyl]-3-(2-oxo-1H-quinolin-3-yl)prop-2-enamide |
| SMILES | COc1ccc(CCCCNC(=O)/C=C/c2cc3ccccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C23H24N2O3/c1-28-20-12-9-17(10-13-20)6-4-5-15-24-22(26)14-11-19-16-18-7-2-3-8-21(18)25-23(19)27/h2-3,7-14,16H,4-6,15H2,1H3,(H,24,26)(H,25,27)/b14-11+ |
| InChIKey | IKDUFIWMASBSCT-SDNWHVSQSA-N |
| XLogP | 3.69 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|