About 4-methyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-pyran-6-ol
4-methyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-pyran-6-ol (PubChem CID 11062800) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is 4-methyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-pyran-6-ol.
Molecular Properties
| Compound Name | 4-methyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-pyran-6-ol |
| PubChem CID | 11062800 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 4-methyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-pyran-6-ol |
| SMILES | CC(C)=CC1CC(C)=CC(O)O1 |
| InChI | InChI=1S/C10H16O2/c1-7(2)4-9-5-8(3)6-10(11)12-9/h4,6,9-11H,5H2,1-3H3 |
| InChIKey | BNVWQUDULKCZTH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-pyran-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-pyran-6-ol?
The IUPAC name of 4-methyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-pyran-6-ol (CID 11062800) is 4-methyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-pyran-6-ol.
What is the SMILES notation for 4-methyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-pyran-6-ol?
The canonical SMILES for 4-methyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-pyran-6-ol is CC(C)=CC1CC(C)=CC(O)O1.
What is the InChIKey of 4-methyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-pyran-6-ol?
The InChIKey is BNVWQUDULKCZTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-7(2)4-9-5-8(3)6-10(11)12-9/h4,6,9-11H,5H2,1-3H3.
What are the key properties of 4-methyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-pyran-6-ol?
4-methyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-pyran-6-ol has a molecular weight of 168.24 g/mol, XLogP of 2.01, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-pyran-6-ol is sourced from PubChem (CID 11062800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).