C11H20O — CID 11062802
(1R,2R,4R)-1,2,7,7-tetramethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 11062802) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (1R,2R,4R)-1,2,7,7-tetramethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2R,4R)-1,2,7,7-tetramethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 11062802 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (1R,2R,4R)-1,2,7,7-tetramethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@](C)(O)C2 |
| InChI | InChI=1S/C11H20O/c1-9(2)8-5-6-10(9,3)11(4,12)7-8/h8,12H,5-7H2,1-4H3/t8-,10-,11-/m1/s1 |
| InChIKey | LFYXNXGVLGKVCJ-FBIMIBRVSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |