C18H21ClN2O2S — CID 110628137
1-(2-chlorophenyl)-N-propyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide (PubChem CID 110628137) has the molecular formula C18H21ClN2O2S and a molecular weight of 364.90 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-propyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide.
| Compound Name | 1-(2-chlorophenyl)-N-propyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide |
|---|---|
| PubChem CID | 110628137 |
| Molecular Formula | C18H21ClN2O2S |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 1-(2-chlorophenyl)-N-propyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide |
| SMILES | CCCNS(=O)(=O)N1CCc2ccccc2C1c1ccccc1Cl |
| InChI | InChI=1S/C18H21ClN2O2S/c1-2-12-20-24(22,23)21-13-11-14-7-3-4-8-15(14)18(21)16-9-5-6-10-17(16)19/h3-10,18,20H,2,11-13H2,1H3 |
| InChIKey | FWRMQIJVDRPLNL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |