About (5R,6S)-5-methyl-1,7-dioxaspiro[5.5]undecane
(5R,6S)-5-methyl-1,7-dioxaspiro[5.5]undecane (PubChem CID 11062843) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is (5R,6S)-5-methyl-1,7-dioxaspiro[5.5]undecane.
Molecular Properties
| Compound Name | (5R,6S)-5-methyl-1,7-dioxaspiro[5.5]undecane |
| PubChem CID | 11062843 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (5R,6S)-5-methyl-1,7-dioxaspiro[5.5]undecane |
| SMILES | C[C@@H]1CCCO[C@@]12CCCCO2 |
| InChI | InChI=1S/C10H18O2/c1-9-5-4-8-12-10(9)6-2-3-7-11-10/h9H,2-8H2,1H3/t9-,10+/m1/s1 |
| InChIKey | SAGPTRBOAZBCFQ-ZJUUUORDSA-N |
| XLogP | 2.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R,6S)-5-methyl-1,7-dioxaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R,6S)-5-methyl-1,7-dioxaspiro[5.5]undecane?
The IUPAC name of (5R,6S)-5-methyl-1,7-dioxaspiro[5.5]undecane (CID 11062843) is (5R,6S)-5-methyl-1,7-dioxaspiro[5.5]undecane.
What is the SMILES notation for (5R,6S)-5-methyl-1,7-dioxaspiro[5.5]undecane?
The canonical SMILES for (5R,6S)-5-methyl-1,7-dioxaspiro[5.5]undecane is C[C@@H]1CCCO[C@@]12CCCCO2.
What is the InChIKey of (5R,6S)-5-methyl-1,7-dioxaspiro[5.5]undecane?
The InChIKey is SAGPTRBOAZBCFQ-ZJUUUORDSA-N. The full InChI is InChI=1S/C10H18O2/c1-9-5-4-8-12-10(9)6-2-3-7-11-10/h9H,2-8H2,1H3/t9-,10+/m1/s1.
What are the key properties of (5R,6S)-5-methyl-1,7-dioxaspiro[5.5]undecane?
(5R,6S)-5-methyl-1,7-dioxaspiro[5.5]undecane has a molecular weight of 170.25 g/mol, XLogP of 2.33, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R,6S)-5-methyl-1,7-dioxaspiro[5.5]undecane is sourced from PubChem (CID 11062843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).