2-amino-3-methyl-2-propylpent-4-enoic acid

C9H17NO2 — CID 11062857

IUPAC2-amino-3-methyl-2-propylpent-4-enoic acid
SMILESC=CC(C)C(N)(CCC)C(=O)O
InChIInChI=1S/C9H17NO2/c1-4-6-9(10,8(11)12)7(3)5-2/h5,7H,2,4,6,10H2,1,3H3,(H,11,12)
InChIKeyMFGQDOFHDRSPAI-UHFFFAOYSA-N
MW171.24 g/mol
LogP1.39
Rot. Bonds5

About 2-amino-3-methyl-2-propylpent-4-enoic acid

2-amino-3-methyl-2-propylpent-4-enoic acid (PubChem CID 11062857) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is 2-amino-3-methyl-2-propylpent-4-enoic acid.

Molecular Properties

Compound Name2-amino-3-methyl-2-propylpent-4-enoic acid
PubChem CID11062857
Molecular FormulaC9H17NO2
Molecular Weight171.24 g/mol
Exact Mass171.13
IUPAC Name2-amino-3-methyl-2-propylpent-4-enoic acid
SMILESC=CC(C)C(N)(CCC)C(=O)O
InChIInChI=1S/C9H17NO2/c1-4-6-9(10,8(11)12)7(3)5-2/h5,7H,2,4,6,10H2,1,3H3,(H,11,12)
InChIKeyMFGQDOFHDRSPAI-UHFFFAOYSA-N
XLogP1.39
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.24
LogP ≤ 51.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-amino-3-methyl-2-propylpent-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-amino-2-propyl-3-sulfanylbutanedioic acid
CID 89375735
(2R)-2-amino-2-propylpent-4-enoic acid
CID 102284688
(2S)-2-amino-2-ethyl-3-methylbutanoic acid
CID 54561958
(3S,4R)-3-methyl-4-phenylhept-1-en-4-amine
CID 101191309
(2R,3R)-2-hydroxy-2,3-dimethylpent-4-enoic acid
CID 13026555
(2R,3S)-2-hydroxy-2,3-dimethylpent-4-enoic acid
CID 13026554
(2S)-2-amino-2-(2-fluoroethyl)-3-methylbutanoic acid
CID 125427224
5-ethyl-4-propyloctan-4-amine;prop-2-enoic acid
CID 173151143
2-amino-3-methyl-2-(2-methylpropyl)pentanoic acid
CID 19431547
4,4-diethyl-5-methylhept-6-en-3-one
CID 71349087
(2R)-2-amino-2-ethenyl-4-methylpentanoic acid
CID 10511127
2,3-diamino-2-(hydroxymethyl)butanoic acid
CID 22035189

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-methyl-2-propylpent-4-enoic acid?
The IUPAC name of 2-amino-3-methyl-2-propylpent-4-enoic acid (CID 11062857) is 2-amino-3-methyl-2-propylpent-4-enoic acid.
What is the SMILES notation for 2-amino-3-methyl-2-propylpent-4-enoic acid?
The canonical SMILES for 2-amino-3-methyl-2-propylpent-4-enoic acid is C=CC(C)C(N)(CCC)C(=O)O.
What is the InChIKey of 2-amino-3-methyl-2-propylpent-4-enoic acid?
The InChIKey is MFGQDOFHDRSPAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-4-6-9(10,8(11)12)7(3)5-2/h5,7H,2,4,6,10H2,1,3H3,(H,11,12).
What are the key properties of 2-amino-3-methyl-2-propylpent-4-enoic acid?
2-amino-3-methyl-2-propylpent-4-enoic acid has a molecular weight of 171.24 g/mol, XLogP of 1.39, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-methyl-2-propylpent-4-enoic acid is sourced from PubChem (CID 11062857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).