C11H10O2 — CID 11062902
(3aR,8bS)-1,3a,4,8b-tetrahydroindeno[2,1-b]furan-2-one (PubChem CID 11062902) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is (3aR,8bS)-1,3a,4,8b-tetrahydroindeno[2,1-b]furan-2-one.
| Compound Name | (3aR,8bS)-1,3a,4,8b-tetrahydroindeno[2,1-b]furan-2-one |
|---|---|
| PubChem CID | 11062902 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (3aR,8bS)-1,3a,4,8b-tetrahydroindeno[2,1-b]furan-2-one |
| SMILES | O=C1C[C@H]2c3ccccc3C[C@H]2O1 |
| InChI | InChI=1S/C11H10O2/c12-11-6-9-8-4-2-1-3-7(8)5-10(9)13-11/h1-4,9-10H,5-6H2/t9-,10+/m0/s1 |
| InChIKey | VVLLCDBDTKYAKY-VHSXEESVSA-N |
| XLogP | 1.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |