C21H24FNO3 — CID 110629573
2-cyclopropyl-2-(4-fluorophenyl)-N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-N-methylacetamide (PubChem CID 110629573) has the molecular formula C21H24FNO3 and a molecular weight of 357.43 g/mol. Its IUPAC name is 2-cyclopropyl-2-(4-fluorophenyl)-N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-N-methylacetamide.
| Compound Name | 2-cyclopropyl-2-(4-fluorophenyl)-N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 110629573 |
| Molecular Formula | C21H24FNO3 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-cyclopropyl-2-(4-fluorophenyl)-N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-N-methylacetamide |
| SMILES | COc1cccc(C(O)CN(C)C(=O)C(c2ccc(F)cc2)C2CC2)c1 |
| InChI | InChI=1S/C21H24FNO3/c1-23(13-19(24)16-4-3-5-18(12-16)26-2)21(25)20(14-6-7-14)15-8-10-17(22)11-9-15/h3-5,8-12,14,19-20,24H,6-7,13H2,1-2H3 |
| InChIKey | DHIJEKYJNJKYML-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |