About 5,6-dimethoxy-2,3-dihydro-1H-indole
5,6-dimethoxy-2,3-dihydro-1H-indole (PubChem CID 11062978) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 5,6-dimethoxy-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 5,6-dimethoxy-2,3-dihydro-1H-indole |
| PubChem CID | 11062978 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 5,6-dimethoxy-2,3-dihydro-1H-indole |
| SMILES | COc1cc2c(cc1OC)NCC2 |
| InChI | InChI=1S/C10H13NO2/c1-12-9-5-7-3-4-11-8(7)6-10(9)13-2/h5-6,11H,3-4H2,1-2H3 |
| InChIKey | DPRMKYPHVPDUIH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dimethoxy-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethoxy-2,3-dihydro-1H-indole?
The IUPAC name of 5,6-dimethoxy-2,3-dihydro-1H-indole (CID 11062978) is 5,6-dimethoxy-2,3-dihydro-1H-indole.
What is the SMILES notation for 5,6-dimethoxy-2,3-dihydro-1H-indole?
The canonical SMILES for 5,6-dimethoxy-2,3-dihydro-1H-indole is COc1cc2c(cc1OC)NCC2.
What is the InChIKey of 5,6-dimethoxy-2,3-dihydro-1H-indole?
The InChIKey is DPRMKYPHVPDUIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-12-9-5-7-3-4-11-8(7)6-10(9)13-2/h5-6,11H,3-4H2,1-2H3.
What are the key properties of 5,6-dimethoxy-2,3-dihydro-1H-indole?
5,6-dimethoxy-2,3-dihydro-1H-indole has a molecular weight of 179.22 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethoxy-2,3-dihydro-1H-indole is sourced from PubChem (CID 11062978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).