C16H18N2O3 — CID 110629831
2-(5-methyl-1,2-oxazol-3-yl)-1-(2-phenylmorpholin-4-yl)ethanone (PubChem CID 110629831) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-(5-methyl-1,2-oxazol-3-yl)-1-(2-phenylmorpholin-4-yl)ethanone.
| Compound Name | 2-(5-methyl-1,2-oxazol-3-yl)-1-(2-phenylmorpholin-4-yl)ethanone |
|---|---|
| PubChem CID | 110629831 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-(5-methyl-1,2-oxazol-3-yl)-1-(2-phenylmorpholin-4-yl)ethanone |
| SMILES | Cc1cc(CC(=O)N2CCOC(c3ccccc3)C2)no1 |
| InChI | InChI=1S/C16H18N2O3/c1-12-9-14(17-21-12)10-16(19)18-7-8-20-15(11-18)13-5-3-2-4-6-13/h2-6,9,15H,7-8,10-11H2,1H3 |
| InChIKey | JZCJBPAWGYEWDV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |