C20H21N3O4 — CID 110630261
2-(4-morpholin-4-ylphenyl)-N-(3-oxo-4H-1,4-benzoxazin-8-yl)acetamide (PubChem CID 110630261) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-(4-morpholin-4-ylphenyl)-N-(3-oxo-4H-1,4-benzoxazin-8-yl)acetamide.
| Compound Name | 2-(4-morpholin-4-ylphenyl)-N-(3-oxo-4H-1,4-benzoxazin-8-yl)acetamide |
|---|---|
| PubChem CID | 110630261 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-(4-morpholin-4-ylphenyl)-N-(3-oxo-4H-1,4-benzoxazin-8-yl)acetamide |
| SMILES | O=C1COc2c(cccc2NC(=O)Cc2ccc(N3CCOCC3)cc2)N1 |
| InChI | InChI=1S/C20H21N3O4/c24-18(21-16-2-1-3-17-20(16)27-13-19(25)22-17)12-14-4-6-15(7-5-14)23-8-10-26-11-9-23/h1-7H,8-13H2,(H,21,24)(H,22,25) |
| InChIKey | BNNMMXFOYVKRJO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|