About (3-cyclohexylimidazo[1,5-a]pyridin-1-yl)-(3,5-dimethylmorpholin-4-yl)methanone
(3-cyclohexylimidazo[1,5-a]pyridin-1-yl)-(3,5-dimethylmorpholin-4-yl)methanone (PubChem CID 110631205) has the molecular formula C20H27N3O2
and a molecular weight of 341.46 g/mol. Its IUPAC name is (3-cyclohexylimidazo[1,5-a]pyridin-1-yl)-(3,5-dimethylmorpholin-4-yl)methanone.
Molecular Properties
| Compound Name | (3-cyclohexylimidazo[1,5-a]pyridin-1-yl)-(3,5-dimethylmorpholin-4-yl)methanone |
| PubChem CID | 110631205 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (3-cyclohexylimidazo[1,5-a]pyridin-1-yl)-(3,5-dimethylmorpholin-4-yl)methanone |
| SMILES | CC1COCC(C)N1C(=O)c1nc(C2CCCCC2)n2ccccc12 |
| InChI | InChI=1S/C20H27N3O2/c1-14-12-25-13-15(2)23(14)20(24)18-17-10-6-7-11-22(17)19(21-18)16-8-4-3-5-9-16/h6-7,10-11,14-16H,3-5,8-9,12-13H2,1-2H3 |
| InChIKey | URUVUBIMQARUIA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-cyclohexylimidazo[1,5-a]pyridin-1-yl)-(3,5-dimethylmorpholin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyclohexylimidazo[1,5-a]pyridin-1-yl)-(3,5-dimethylmorpholin-4-yl)methanone?
The IUPAC name of (3-cyclohexylimidazo[1,5-a]pyridin-1-yl)-(3,5-dimethylmorpholin-4-yl)methanone (CID 110631205) is (3-cyclohexylimidazo[1,5-a]pyridin-1-yl)-(3,5-dimethylmorpholin-4-yl)methanone.
What is the SMILES notation for (3-cyclohexylimidazo[1,5-a]pyridin-1-yl)-(3,5-dimethylmorpholin-4-yl)methanone?
The canonical SMILES for (3-cyclohexylimidazo[1,5-a]pyridin-1-yl)-(3,5-dimethylmorpholin-4-yl)methanone is CC1COCC(C)N1C(=O)c1nc(C2CCCCC2)n2ccccc12.
What is the InChIKey of (3-cyclohexylimidazo[1,5-a]pyridin-1-yl)-(3,5-dimethylmorpholin-4-yl)methanone?
The InChIKey is URUVUBIMQARUIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3O2/c1-14-12-25-13-15(2)23(14)20(24)18-17-10-6-7-11-22(17)19(21-18)16-8-4-3-5-9-16/h6-7,10-11,14-16H,3-5,8-9,12-13H2,1-2H3.
What are the key properties of (3-cyclohexylimidazo[1,5-a]pyridin-1-yl)-(3,5-dimethylmorpholin-4-yl)methanone?
(3-cyclohexylimidazo[1,5-a]pyridin-1-yl)-(3,5-dimethylmorpholin-4-yl)methanone has a molecular weight of 341.46 g/mol, XLogP of 3.63, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyclohexylimidazo[1,5-a]pyridin-1-yl)-(3,5-dimethylmorpholin-4-yl)methanone is sourced from PubChem (CID 110631205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).