C17H22N2O3 — CID 110631322
1-benzyl-5-(2-methylmorpholine-4-carbonyl)pyrrolidin-2-one (PubChem CID 110631322) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 1-benzyl-5-(2-methylmorpholine-4-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-benzyl-5-(2-methylmorpholine-4-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 110631322 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1-benzyl-5-(2-methylmorpholine-4-carbonyl)pyrrolidin-2-one |
| SMILES | CC1CN(C(=O)C2CCC(=O)N2Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C17H22N2O3/c1-13-11-18(9-10-22-13)17(21)15-7-8-16(20)19(15)12-14-5-3-2-4-6-14/h2-6,13,15H,7-12H2,1H3 |
| InChIKey | FTUGGQAIXMVWMQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |