C17H24ClNO2 — CID 110631434
3-(3-chlorophenyl)-N-[[1-(hydroxymethyl)cyclohexyl]methyl]propanamide (PubChem CID 110631434) has the molecular formula C17H24ClNO2 and a molecular weight of 309.84 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-[[1-(hydroxymethyl)cyclohexyl]methyl]propanamide.
| Compound Name | 3-(3-chlorophenyl)-N-[[1-(hydroxymethyl)cyclohexyl]methyl]propanamide |
|---|---|
| PubChem CID | 110631434 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 3-(3-chlorophenyl)-N-[[1-(hydroxymethyl)cyclohexyl]methyl]propanamide |
| SMILES | O=C(CCc1cccc(Cl)c1)NCC1(CO)CCCCC1 |
| InChI | InChI=1S/C17H24ClNO2/c18-15-6-4-5-14(11-15)7-8-16(21)19-12-17(13-20)9-2-1-3-10-17/h4-6,11,20H,1-3,7-10,12-13H2,(H,19,21) |
| InChIKey | SBHAKOKSNSNPQT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |