C17H25N3O3S — CID 110632659
N-cyclopentyl-4-(3-methylbenzoyl)piperazine-1-sulfonamide (PubChem CID 110632659) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is N-cyclopentyl-4-(3-methylbenzoyl)piperazine-1-sulfonamide.
| Compound Name | N-cyclopentyl-4-(3-methylbenzoyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 110632659 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-cyclopentyl-4-(3-methylbenzoyl)piperazine-1-sulfonamide |
| SMILES | Cc1cccc(C(=O)N2CCN(S(=O)(=O)NC3CCCC3)CC2)c1 |
| InChI | InChI=1S/C17H25N3O3S/c1-14-5-4-6-15(13-14)17(21)19-9-11-20(12-10-19)24(22,23)18-16-7-2-3-8-16/h4-6,13,16,18H,2-3,7-12H2,1H3 |
| InChIKey | AGYKWWPZEIPWIG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |