C23H24N2O4 — CID 110632886
N-[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]-2-(oxan-2-yl)acetamide (PubChem CID 110632886) has the molecular formula C23H24N2O4 and a molecular weight of 392.45 g/mol. Its IUPAC name is N-[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]-2-(oxan-2-yl)acetamide.
| Compound Name | N-[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]-2-(oxan-2-yl)acetamide |
|---|---|
| PubChem CID | 110632886 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]-2-(oxan-2-yl)acetamide |
| SMILES | O=C(CC1CCCCO1)Nc1ccc(CCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C23H24N2O4/c26-21(15-18-5-3-4-14-29-18)24-17-10-8-16(9-11-17)12-13-25-22(27)19-6-1-2-7-20(19)23(25)28/h1-2,6-11,18H,3-5,12-15H2,(H,24,26) |
| InChIKey | NKPKLZNWJPKYMH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|