About 2-hydroxy-3-(5-methyl-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one
2-hydroxy-3-(5-methyl-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one (PubChem CID 11063341) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is 2-hydroxy-3-(5-methyl-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one.
Molecular Properties
| Compound Name | 2-hydroxy-3-(5-methyl-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one |
| PubChem CID | 11063341 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2-hydroxy-3-(5-methyl-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one |
| SMILES | CC1=CCC(C2=CC(=O)OC2O)OC1 |
| InChI | InChI=1S/C10H12O4/c1-6-2-3-8(13-5-6)7-4-9(11)14-10(7)12/h2,4,8,10,12H,3,5H2,1H3 |
| InChIKey | FLNHFWSNSDPSEK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3-(5-methyl-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-(5-methyl-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one?
The IUPAC name of 2-hydroxy-3-(5-methyl-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one (CID 11063341) is 2-hydroxy-3-(5-methyl-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one.
What is the SMILES notation for 2-hydroxy-3-(5-methyl-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one?
The canonical SMILES for 2-hydroxy-3-(5-methyl-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one is CC1=CCC(C2=CC(=O)OC2O)OC1.
What is the InChIKey of 2-hydroxy-3-(5-methyl-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one?
The InChIKey is FLNHFWSNSDPSEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4/c1-6-2-3-8(13-5-6)7-4-9(11)14-10(7)12/h2,4,8,10,12H,3,5H2,1H3.
What are the key properties of 2-hydroxy-3-(5-methyl-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one?
2-hydroxy-3-(5-methyl-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one has a molecular weight of 196.20 g/mol, XLogP of 0.52, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-(5-methyl-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one is sourced from PubChem (CID 11063341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).