C18H25N3O5S — CID 110633485
3-(4-acetamidophenyl)sulfonyl-N-(2-oxo-2-piperidin-1-ylethyl)propanamide (PubChem CID 110633485) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is 3-(4-acetamidophenyl)sulfonyl-N-(2-oxo-2-piperidin-1-ylethyl)propanamide.
| Compound Name | 3-(4-acetamidophenyl)sulfonyl-N-(2-oxo-2-piperidin-1-ylethyl)propanamide |
|---|---|
| PubChem CID | 110633485 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 3-(4-acetamidophenyl)sulfonyl-N-(2-oxo-2-piperidin-1-ylethyl)propanamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)CCC(=O)NCC(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C18H25N3O5S/c1-14(22)20-15-5-7-16(8-6-15)27(25,26)12-9-17(23)19-13-18(24)21-10-3-2-4-11-21/h5-8H,2-4,9-13H2,1H3,(H,19,23)(H,20,22) |
| InChIKey | HTKFVWFBBNWSCG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |