C24H29N3O2 — CID 110633794
5-oxo-1-phenyl-N-[4-(3-pyrrolidin-1-ylpropyl)phenyl]pyrrolidine-2-carboxamide (PubChem CID 110633794) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is 5-oxo-1-phenyl-N-[4-(3-pyrrolidin-1-ylpropyl)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | 5-oxo-1-phenyl-N-[4-(3-pyrrolidin-1-ylpropyl)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110633794 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 5-oxo-1-phenyl-N-[4-(3-pyrrolidin-1-ylpropyl)phenyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(CCCN2CCCC2)cc1)C1CCC(=O)N1c1ccccc1 |
| InChI | InChI=1S/C24H29N3O2/c28-23-15-14-22(27(23)21-8-2-1-3-9-21)24(29)25-20-12-10-19(11-13-20)7-6-18-26-16-4-5-17-26/h1-3,8-13,22H,4-7,14-18H2,(H,25,29) |
| InChIKey | SEQSCAYELUPTBG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |