C11H8N2S — CID 11063448
2-methyl-4-(2-pyridin-2-ylethynyl)-1,3-thiazole (PubChem CID 11063448) has the molecular formula C11H8N2S and a molecular weight of 200.27 g/mol. Its IUPAC name is 2-methyl-4-(2-pyridin-2-ylethynyl)-1,3-thiazole.
| Compound Name | 2-methyl-4-(2-pyridin-2-ylethynyl)-1,3-thiazole |
|---|---|
| PubChem CID | 11063448 |
| Molecular Formula | C11H8N2S |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 2-methyl-4-(2-pyridin-2-ylethynyl)-1,3-thiazole |
| SMILES | Cc1nc(C#Cc2ccccn2)cs1 |
| InChI | InChI=1S/C11H8N2S/c1-9-13-11(8-14-9)6-5-10-4-2-3-7-12-10/h2-4,7-8H,1H3 |
| InChIKey | BQDSXKBRSCMFRW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|