C15H23N3O2S — CID 110634605
3-phenyl-N-propyl-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazole-2-sulfonamide (PubChem CID 110634605) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 3-phenyl-N-propyl-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazole-2-sulfonamide.
| Compound Name | 3-phenyl-N-propyl-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazole-2-sulfonamide |
|---|---|
| PubChem CID | 110634605 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 3-phenyl-N-propyl-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazole-2-sulfonamide |
| SMILES | CCCNS(=O)(=O)N1CC2CCCN2C1c1ccccc1 |
| InChI | InChI=1S/C15H23N3O2S/c1-2-10-16-21(19,20)18-12-14-9-6-11-17(14)15(18)13-7-4-3-5-8-13/h3-5,7-8,14-16H,2,6,9-12H2,1H3 |
| InChIKey | ILLWELAMACOEJM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |