About 1-[2-(4-chlorophenoxy)acetyl]-6-fluoro-2,3-dihydroquinolin-4-one
1-[2-(4-chlorophenoxy)acetyl]-6-fluoro-2,3-dihydroquinolin-4-one (PubChem CID 110635087) has the molecular formula C17H13ClFNO3
and a molecular weight of 333.75 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)acetyl]-6-fluoro-2,3-dihydroquinolin-4-one.
Molecular Properties
| Compound Name | 1-[2-(4-chlorophenoxy)acetyl]-6-fluoro-2,3-dihydroquinolin-4-one |
| PubChem CID | 110635087 |
| Molecular Formula | C17H13ClFNO3 |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)acetyl]-6-fluoro-2,3-dihydroquinolin-4-one |
| SMILES | O=C1CCN(C(=O)COc2ccc(Cl)cc2)c2ccc(F)cc21 |
| InChI | InChI=1S/C17H13ClFNO3/c18-11-1-4-13(5-2-11)23-10-17(22)20-8-7-16(21)14-9-12(19)3-6-15(14)20/h1-6,9H,7-8,10H2 |
| InChIKey | MFFKVSPFBOMZAN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(4-chlorophenoxy)acetyl]-6-fluoro-2,3-dihydroquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-chlorophenoxy)acetyl]-6-fluoro-2,3-dihydroquinolin-4-one?
The IUPAC name of 1-[2-(4-chlorophenoxy)acetyl]-6-fluoro-2,3-dihydroquinolin-4-one (CID 110635087) is 1-[2-(4-chlorophenoxy)acetyl]-6-fluoro-2,3-dihydroquinolin-4-one.
What is the SMILES notation for 1-[2-(4-chlorophenoxy)acetyl]-6-fluoro-2,3-dihydroquinolin-4-one?
The canonical SMILES for 1-[2-(4-chlorophenoxy)acetyl]-6-fluoro-2,3-dihydroquinolin-4-one is O=C1CCN(C(=O)COc2ccc(Cl)cc2)c2ccc(F)cc21.
What is the InChIKey of 1-[2-(4-chlorophenoxy)acetyl]-6-fluoro-2,3-dihydroquinolin-4-one?
The InChIKey is MFFKVSPFBOMZAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClFNO3/c18-11-1-4-13(5-2-11)23-10-17(22)20-8-7-16(21)14-9-12(19)3-6-15(14)20/h1-6,9H,7-8,10H2.
What are the key properties of 1-[2-(4-chlorophenoxy)acetyl]-6-fluoro-2,3-dihydroquinolin-4-one?
1-[2-(4-chlorophenoxy)acetyl]-6-fluoro-2,3-dihydroquinolin-4-one has a molecular weight of 333.75 g/mol, XLogP of 3.48, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-chlorophenoxy)acetyl]-6-fluoro-2,3-dihydroquinolin-4-one is sourced from PubChem (CID 110635087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).