C15H11N — CID 11063579
tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-imine (PubChem CID 11063579) has the molecular formula C15H11N and a molecular weight of 205.26 g/mol. Its IUPAC name is tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-imine.
| Compound Name | tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-imine |
|---|---|
| PubChem CID | 11063579 |
| Molecular Formula | C15H11N |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-imine |
| SMILES | [H]N=c1c2ccccc2ccc2ccccc12 |
| InChI | InChI=1S/C15H11N/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-10,16H |
| InChIKey | SRAKKTAMBIWGQN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |